About 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile
3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 127049375) has the molecular formula C12H9F6NO
and a molecular weight of 297.20 g/mol. Its IUPAC name is 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile |
| PubChem CID | 127049375 |
| Molecular Formula | C12H9F6NO |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1c(C(C)(O)C(F)(F)F)ccc(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C12H9F6NO/c1-6-8(10(2,20)12(16,17)18)4-3-7(5-19)9(6)11(13,14)15/h3-4,20H,1-2H3 |
| InChIKey | RPRIQIQXZRSMBO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile?
The IUPAC name of 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile (CID 127049375) is 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile?
The canonical SMILES for 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile is Cc1c(C(C)(O)C(F)(F)F)ccc(C#N)c1C(F)(F)F.
What is the InChIKey of 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile?
The InChIKey is RPRIQIQXZRSMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F6NO/c1-6-8(10(2,20)12(16,17)18)4-3-7(5-19)9(6)11(13,14)15/h3-4,20H,1-2H3.
What are the key properties of 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile?
3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile has a molecular weight of 297.20 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 127049375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).