C25H30O6 — CID 127049457
ethyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate (PubChem CID 127049457) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate.
| Compound Name | ethyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate |
|---|---|
| PubChem CID | 127049457 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | ethyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(C(=O)OCC)c1ccccc1)=C/CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C25H30O6/c1-4-28-24(27)20(18-10-6-5-7-11-18)29-15-17-9-8-14-25(3)22(31-25)21-19(13-12-17)16(2)23(26)30-21/h5-7,9-11,19-22H,2,4,8,12-15H2,1,3H3/b17-9-/t19-,20?,21-,22-,25+/m0/s1 |
| InChIKey | MWSKNOPYFUXNCP-ZFFGOSTCSA-N |
| XLogP | 4.06 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|