C20H31N3O3 — CID 127049460
(2S,3R)-2-[4-(3-hydroxyphenyl)triazol-1-yl]dodecane-1,3-diol (PubChem CID 127049460) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2S,3R)-2-[4-(3-hydroxyphenyl)triazol-1-yl]dodecane-1,3-diol.
| Compound Name | (2S,3R)-2-[4-(3-hydroxyphenyl)triazol-1-yl]dodecane-1,3-diol |
|---|---|
| PubChem CID | 127049460 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (2S,3R)-2-[4-(3-hydroxyphenyl)triazol-1-yl]dodecane-1,3-diol |
| SMILES | CCCCCCCCC[C@@H](O)[C@H](CO)n1cc(-c2cccc(O)c2)nn1 |
| InChI | InChI=1S/C20H31N3O3/c1-2-3-4-5-6-7-8-12-20(26)19(15-24)23-14-18(21-22-23)16-10-9-11-17(25)13-16/h9-11,13-14,19-20,24-26H,2-8,12,15H2,1H3/t19-,20+/m0/s1 |
| InChIKey | QFTZABFSCWNPKY-VQTJNVASSA-N |
| XLogP | 3.69 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|