C30H32O6 — CID 127049482
benzyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate (PubChem CID 127049482) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is benzyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate.
| Compound Name | benzyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate |
|---|---|
| PubChem CID | 127049482 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | benzyl 2-[[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methoxy]-2-phenylacetate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(C(=O)OCc1ccccc1)c1ccccc1)=C/CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C30H32O6/c1-20-24-16-15-22(12-9-17-30(2)27(36-30)26(24)35-28(20)31)18-33-25(23-13-7-4-8-14-23)29(32)34-19-21-10-5-3-6-11-21/h3-8,10-14,24-27H,1,9,15-19H2,2H3/b22-12-/t24-,25?,26-,27-,30+/m0/s1 |
| InChIKey | OCWJXELQODIRKI-DHPVBJDVSA-N |
| XLogP | 5.24 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|