C21H27N5O4 — CID 127049617
N-hydroxy-N-[(2R)-2-[(6S)-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]formamide (PubChem CID 127049617) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-2-[(6S)-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]formamide.
| Compound Name | N-hydroxy-N-[(2R)-2-[(6S)-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]formamide |
|---|---|
| PubChem CID | 127049617 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-hydroxy-N-[(2R)-2-[(6S)-6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-5-azaspiro[2.4]heptane-5-carbonyl]hexyl]formamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CC2(CC2)C[C@H]1c1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C21H27N5O4/c1-2-3-5-16(12-25(29)14-27)20(28)26-13-21(7-8-21)10-17(26)19-23-18(24-30-19)15-6-4-9-22-11-15/h4,6,9,11,14,16-17,29H,2-3,5,7-8,10,12-13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | NKSYWTFNRYKVSW-SJORKVTESA-N |
| XLogP | 2.84 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|