C36H44Cl2N4 — CID 127049638
N,N'-bis(6-chloro-3,3-dimethyl-2,4-dihydro-1H-acridin-9-yl)hexane-1,6-diamine (PubChem CID 127049638) has the molecular formula C36H44Cl2N4 and a molecular weight of 603.68 g/mol. Its IUPAC name is N,N'-bis(6-chloro-3,3-dimethyl-2,4-dihydro-1H-acridin-9-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(6-chloro-3,3-dimethyl-2,4-dihydro-1H-acridin-9-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 127049638 |
| Molecular Formula | C36H44Cl2N4 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | N,N'-bis(6-chloro-3,3-dimethyl-2,4-dihydro-1H-acridin-9-yl)hexane-1,6-diamine |
| SMILES | CC1(C)CCc2c(nc3cc(Cl)ccc3c2NCCCCCCNc2c3c(nc4cc(Cl)ccc24)CC(C)(C)CC3)C1 |
| InChI | InChI=1S/C36H44Cl2N4/c1-35(2)15-13-27-31(21-35)41-29-19-23(37)9-11-25(29)33(27)39-17-7-5-6-8-18-40-34-26-12-10-24(38)20-30(26)42-32-22-36(3,4)16-14-28(32)34/h9-12,19-20H,5-8,13-18,21-22H2,1-4H3,(H,39,41)(H,40,42) |
| InChIKey | QCGYZXYLGVAQNY-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|