C21H30O6 — CID 127049680
(2R,3aS)-3a,6-dihydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one (PubChem CID 127049680) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2R,3aS)-3a,6-dihydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one.
| Compound Name | (2R,3aS)-3a,6-dihydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 127049680 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (2R,3aS)-3a,6-dihydroxy-2-(2-hydroxypropan-2-yl)-5-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one |
| SMILES | CC(C)=CCC1=C2O[C@@H](C(C)(C)O)C[C@@]2(O)C(=O)C(C(=O)CC(C)C)=C1O |
| InChI | InChI=1S/C21H30O6/c1-11(2)7-8-13-17(23)16(14(22)9-12(3)4)18(24)21(26)10-15(20(5,6)25)27-19(13)21/h7,12,15,23,25-26H,8-10H2,1-6H3/t15-,21-/m1/s1 |
| InChIKey | DXPAMBUYLZRLIJ-QVKFZJNVSA-N |
| XLogP | 2.90 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|