C23H23F3O5 — CID 127049793
[(1S,2S,4R,7E,9S,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 4-(trifluoromethyl)benzoate (PubChem CID 127049793) has the molecular formula C23H23F3O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is [(1S,2S,4R,7E,9S,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(1S,2S,4R,7E,9S,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 127049793 |
| Molecular Formula | C23H23F3O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [(1S,2S,4R,7E,9S,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 4-(trifluoromethyl)benzoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1C[C@H](OC(=O)c1ccc(C(F)(F)F)cc1)/C(C)=C/CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C23H23F3O5/c1-12-5-4-10-22(3)19(31-22)18-16(13(2)20(27)30-18)11-17(12)29-21(28)14-6-8-15(9-7-14)23(24,25)26/h5-9,16-19H,2,4,10-11H2,1,3H3/b12-5+/t16-,17-,18-,19-,22+/m0/s1 |
| InChIKey | WZBUAPITNNWISM-FWAPJQQZSA-N |
| XLogP | 4.62 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|