C21H23N3O2 — CID 127050022
(2S)-1-[(3aS,4R,7aR)-2-benzyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindole-4-carbonyl]pyrrolidine-2-carbonitrile (PubChem CID 127050022) has the molecular formula C21H23N3O2 and a molecular weight of 349.40 g/mol. Its IUPAC name is (2S)-1-[(3aS,4R,7aR)-2-benzyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindole-4-carbonyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[(3aS,4R,7aR)-2-benzyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindole-4-carbonyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 127050022 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2S)-1-[(3aS,4R,7aR)-2-benzyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindole-4-carbonyl]pyrrolidine-2-carbonitrile |
| SMILES | C1C[C@H](N(C1)C(=O)[C@@H]2CC=C[C@@H]3[C@@H]2C(=O)N(C3)CC4=CC=CC=C4)C#N |
| InChI | InChI=1S/C21H23N3O2/c22-12-17-9-5-11-24(17)20(25)18-10-4-8-16-14-23(21(26)19(16)18)13-15-6-2-1-3-7-15/h1-4,6-8,16-19H,5,9-11,13-14H2/t16-,17-,18+,19-/m0/s1 |
| InChIKey | RSPHQZYIDJUMKI-OKYOBFRVSA-N |
| XLogP | 1.70 |
| TPSA | 64.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | 643 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|