About N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide
N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide (PubChem CID 127050114) has the molecular formula C17H17Br2NO3
and a molecular weight of 443.14 g/mol. Its IUPAC name is N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide |
| PubChem CID | 127050114 |
| Molecular Formula | C17H17Br2NO3 |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Br)c(Oc2ccc(O)c(C(C)C)c2)c(Br)c1 |
| InChI | InChI=1S/C17H17Br2NO3/c1-9(2)13-8-12(4-5-16(13)22)23-17-14(18)6-11(7-15(17)19)20-10(3)21/h4-9,22H,1-3H3,(H,20,21) |
| InChIKey | YXQSFXPKCKXYNH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide?
The IUPAC name of N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide (CID 127050114) is N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide.
What is the SMILES notation for N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide?
The canonical SMILES for N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide is CC(=O)Nc1cc(Br)c(Oc2ccc(O)c(C(C)C)c2)c(Br)c1.
What is the InChIKey of N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide?
The InChIKey is YXQSFXPKCKXYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Br2NO3/c1-9(2)13-8-12(4-5-16(13)22)23-17-14(18)6-11(7-15(17)19)20-10(3)21/h4-9,22H,1-3H3,(H,20,21).
What are the key properties of N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide?
N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide has a molecular weight of 443.14 g/mol, XLogP of 5.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetamide is sourced from PubChem (CID 127050114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).