C24H12N2O9 — CID 127050398
5-hydroxy-3,7-bis(2-nitrophenyl)pyrano[3,2-g]chromene-4,6-dione (PubChem CID 127050398) has the molecular formula C24H12N2O9 and a molecular weight of 472.37 g/mol. Its IUPAC name is 5-hydroxy-3,7-bis(2-nitrophenyl)pyrano[3,2-g]chromene-4,6-dione.
| Compound Name | 5-hydroxy-3,7-bis(2-nitrophenyl)pyrano[3,2-g]chromene-4,6-dione |
|---|---|
| PubChem CID | 127050398 |
| Molecular Formula | C24H12N2O9 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 5-hydroxy-3,7-bis(2-nitrophenyl)pyrano[3,2-g]chromene-4,6-dione |
| SMILES | O=c1c(-c2ccccc2[N+](=O)[O-])coc2cc3occ(-c4ccccc4[N+](=O)[O-])c(=O)c3c(O)c12 |
| InChI | InChI=1S/C24H12N2O9/c27-22-14(12-5-1-3-7-16(12)25(30)31)10-34-18-9-19-21(24(29)20(18)22)23(28)15(11-35-19)13-6-2-4-8-17(13)26(32)33/h1-11,29H |
| InChIKey | JEJJTKYZWJVMHL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|