C20H20F3NO5S — CID 127050452
2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[[4-(trifluoromethyl)phenoxy]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 127050452) has the molecular formula C20H20F3NO5S and a molecular weight of 443.44 g/mol. Its IUPAC name is 2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[[4-(trifluoromethyl)phenoxy]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[[4-(trifluoromethyl)phenoxy]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 127050452 |
| Molecular Formula | C20H20F3NO5S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[[4-(trifluoromethyl)phenoxy]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc([C@H]2CC[C@@H]3[C@@H](COc4ccc(C(F)(F)F)cc4)[C@H](O)C[C@@H]3O2)n1 |
| InChI | InChI=1S/C20H20F3NO5S/c21-20(22,23)10-1-3-11(4-2-10)28-8-13-12-5-6-16(29-17(12)7-15(13)25)18-24-14(9-30-18)19(26)27/h1-4,9,12-13,15-17,25H,5-8H2,(H,26,27)/t12-,13-,15-,16-,17+/m1/s1 |
| InChIKey | NXPYCPHZYFQSFQ-HSMRXVHUSA-N |
| XLogP | 4.16 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |