C26H12F6O7 — CID 127050507
5-hydroxy-3,7-bis[4-(trifluoromethoxy)phenyl]pyrano[3,2-g]chromene-4,6-dione (PubChem CID 127050507) has the molecular formula C26H12F6O7 and a molecular weight of 550.36 g/mol. Its IUPAC name is 5-hydroxy-3,7-bis[4-(trifluoromethoxy)phenyl]pyrano[3,2-g]chromene-4,6-dione.
| Compound Name | 5-hydroxy-3,7-bis[4-(trifluoromethoxy)phenyl]pyrano[3,2-g]chromene-4,6-dione |
|---|---|
| PubChem CID | 127050507 |
| Molecular Formula | C26H12F6O7 |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 5-hydroxy-3,7-bis[4-(trifluoromethoxy)phenyl]pyrano[3,2-g]chromene-4,6-dione |
| SMILES | O=c1c(-c2ccc(OC(F)(F)F)cc2)coc2cc3occ(-c4ccc(OC(F)(F)F)cc4)c(=O)c3c(O)c12 |
| InChI | InChI=1S/C26H12F6O7/c27-25(28,29)38-14-5-1-12(2-6-14)16-10-36-18-9-19-21(24(35)20(18)22(16)33)23(34)17(11-37-19)13-3-7-15(8-4-13)39-26(30,31)32/h1-11,35H |
| InChIKey | DXGSMCYNNNOXLE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|