C32H48O6 — CID 127050567
methyl 2-[(1R,5R,7S)-3-butanoyl-4-hydroxy-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-2,9-dioxo-1-bicyclo[3.3.1]non-3-enyl]hexanoate (PubChem CID 127050567) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is methyl 2-[(1R,5R,7S)-3-butanoyl-4-hydroxy-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-2,9-dioxo-1-bicyclo[3.3.1]non-3-enyl]hexanoate.
| Compound Name | methyl 2-[(1R,5R,7S)-3-butanoyl-4-hydroxy-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-2,9-dioxo-1-bicyclo[3.3.1]non-3-enyl]hexanoate |
|---|---|
| PubChem CID | 127050567 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | methyl 2-[(1R,5R,7S)-3-butanoyl-4-hydroxy-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-2,9-dioxo-1-bicyclo[3.3.1]non-3-enyl]hexanoate |
| SMILES | CCCCC(C(=O)OC)[C@@]12C(=O)C(C(=O)CCC)=C(O)[C@@](CC=C(C)C)(C[C@H](CC=C(C)C)C1(C)C)C2=O |
| InChI | InChI=1S/C32H48O6/c1-10-12-14-23(28(36)38-9)32-27(35)25(24(33)13-11-2)26(34)31(29(32)37,18-17-21(5)6)19-22(30(32,7)8)16-15-20(3)4/h15,17,22-23,34H,10-14,16,18-19H2,1-9H3/t22-,23?,31+,32-/m0/s1 |
| InChIKey | WESJNGNAWRRJCB-HJPILNIBSA-N |
| XLogP | 7.03 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|