C19H19NO4 — CID 127050611
ethyl (1S,2S,3S,4R)-1'-acetyl-2'-oxospiro[bicyclo[2.2.1]hept-5-ene-3,3'-indole]-2-carboxylate (PubChem CID 127050611) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl (1S,2S,3S,4R)-1'-acetyl-2'-oxospiro[bicyclo[2.2.1]hept-5-ene-3,3'-indole]-2-carboxylate.
| Compound Name | ethyl (1S,2S,3S,4R)-1'-acetyl-2'-oxospiro[bicyclo[2.2.1]hept-5-ene-3,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 127050611 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl (1S,2S,3S,4R)-1'-acetyl-2'-oxospiro[bicyclo[2.2.1]hept-5-ene-3,3'-indole]-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2C=C[C@@H](C2)[C@]12C(=O)N(C(C)=O)c1ccccc12 |
| InChI | InChI=1S/C19H19NO4/c1-3-24-17(22)16-12-8-9-13(10-12)19(16)14-6-4-5-7-15(14)20(11(2)21)18(19)23/h4-9,12-13,16H,3,10H2,1-2H3/t12-,13+,16-,19-/m1/s1 |
| InChIKey | JRGDFVNHEOLBRL-UESRRSCYSA-N |
| XLogP | 2.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|