C23H24Cl2N6O2 — CID 127050657
N-[5-(4-chlorophenyl)-2-[N'-[2-(3-chlorophenyl)ethyl]-N-cyanocarbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide (PubChem CID 127050657) has the molecular formula C23H24Cl2N6O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-2-[N'-[2-(3-chlorophenyl)ethyl]-N-cyanocarbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide.
| Compound Name | N-[5-(4-chlorophenyl)-2-[N'-[2-(3-chlorophenyl)ethyl]-N-cyanocarbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 127050657 |
| Molecular Formula | C23H24Cl2N6O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-[5-(4-chlorophenyl)-2-[N'-[2-(3-chlorophenyl)ethyl]-N-cyanocarbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide |
| SMILES | CCN(C(=O)CO)C1CN(/C(=N/CCc2cccc(Cl)c2)NC#N)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24Cl2N6O2/c1-2-30(21(33)14-32)20-13-31(29-22(20)17-6-8-18(24)9-7-17)23(28-15-26)27-11-10-16-4-3-5-19(25)12-16/h3-9,12,20,32H,2,10-11,13-14H2,1H3,(H,27,28) |
| InChIKey | XNIAJVBBQGWZHD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|