C21H19F6N5 — CID 127050759
(1S,2R,5S)-5-[11-(trifluoromethyl)-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 127050759) has the molecular formula C21H19F6N5 and a molecular weight of 455.41 g/mol. Its IUPAC name is (1S,2R,5S)-5-[11-(trifluoromethyl)-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-5-[11-(trifluoromethyl)-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 127050759 |
| Molecular Formula | C21H19F6N5 |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (1S,2R,5S)-5-[11-(trifluoromethyl)-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3nn4ccc(C(F)(F)F)nc4c3C2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H19F6N5/c22-14-7-16(24)15(23)6-12(14)11-2-1-10(5-17(11)28)31-8-13-18(9-31)30-32-4-3-19(21(25,26)27)29-20(13)32/h3-4,6-7,10-11,17H,1-2,5,8-9,28H2/t10-,11+,17-/m0/s1 |
| InChIKey | BYUIFKFIYQUVLS-RVPKQNPDSA-N |
| XLogP | 4.14 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|