C22H25NO4 — CID 127050789
ethyl (3S,4R,5S)-1-benzyl-5-hydroxy-4-(4-methylphenyl)-2-oxopiperidine-3-carboxylate (PubChem CID 127050789) has the molecular formula C22H25NO4 and a molecular weight of 367.40 g/mol. Its IUPAC name is ethyl (3S,4R,5S)-1-benzyl-5-hydroxy-4-(4-methylphenyl)-2-oxopiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R,5S)-1-benzyl-5-hydroxy-4-(4-methylphenyl)-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 127050789 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl (3S,4R,5S)-1-benzyl-5-hydroxy-4-(4-methylphenyl)-2-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]([C@@H](CN(C1=O)CC2=CC=CC=C2)O)C3=CC=C(C=C3)C |
| InChI | InChI=1S/C22H25NO4/c1-3-27-22(26)20-19(17-11-9-15(2)10-12-17)18(24)14-23(21(20)25)13-16-7-5-4-6-8-16/h4-12,18-20,24H,3,13-14H2,1-2H3/t18-,19-,20+/m1/s1 |
| InChIKey | RMNQJZHCXIMRHQ-AQNXPRMDSA-N |
| XLogP | 2.90 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | 508 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|