C25H20FN3O2 — CID 127050794
(Z)-1-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-(4-methoxyanilino)prop-2-en-1-one (PubChem CID 127050794) has the molecular formula C25H20FN3O2 and a molecular weight of 413.45 g/mol. Its IUPAC name is (Z)-1-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-(4-methoxyanilino)prop-2-en-1-one.
| Compound Name | (Z)-1-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-(4-methoxyanilino)prop-2-en-1-one |
|---|---|
| PubChem CID | 127050794 |
| Molecular Formula | C25H20FN3O2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (Z)-1-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-(4-methoxyanilino)prop-2-en-1-one |
| SMILES | COc1ccc(N/C=C\C(=O)c2cn(-c3ccccc3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H20FN3O2/c1-31-22-13-11-20(12-14-22)27-16-15-24(30)23-17-29(21-5-3-2-4-6-21)28-25(23)18-7-9-19(26)10-8-18/h2-17,27H,1H3/b16-15- |
| InChIKey | CHIVYXWZAIGRIN-NXVVXOECSA-N |
| XLogP | 5.50 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|