About N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide
N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide (PubChem CID 127050820) has the molecular formula C26H25Cl2NO
and a molecular weight of 438.40 g/mol. Its IUPAC name is N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide |
| PubChem CID | 127050820 |
| Molecular Formula | C26H25Cl2NO |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide |
| SMILES | CC/C(=C(/c1ccccc1)c1ccc(NC(=O)C(C)C)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H25Cl2NO/c1-4-22(23-15-12-20(27)16-24(23)28)25(18-8-6-5-7-9-18)19-10-13-21(14-11-19)29-26(30)17(2)3/h5-17H,4H2,1-3H3,(H,29,30)/b25-22+ |
| InChIKey | GZJYCMOCENYDKE-YYDJUVGSSA-N |
| XLogP | 7.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide?
The IUPAC name of N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide (CID 127050820) is N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide.
What is the SMILES notation for N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide?
The canonical SMILES for N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide is CC/C(=C(/c1ccccc1)c1ccc(NC(=O)C(C)C)cc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide?
The InChIKey is GZJYCMOCENYDKE-YYDJUVGSSA-N. The full InChI is InChI=1S/C26H25Cl2NO/c1-4-22(23-15-12-20(27)16-24(23)28)25(18-8-6-5-7-9-18)19-10-13-21(14-11-19)29-26(30)17(2)3/h5-17H,4H2,1-3H3,(H,29,30)/b25-22+.
What are the key properties of N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide?
N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide has a molecular weight of 438.40 g/mol, XLogP of 7.96, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-2-(2,4-dichlorophenyl)-1-phenylbut-1-enyl]phenyl]-2-methylpropanamide is sourced from PubChem (CID 127050820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).