C26H19BrN2S2 — CID 127051001
13-(4-bromophenyl)-11-(4-methylphenyl)-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene (PubChem CID 127051001) has the molecular formula C26H19BrN2S2 and a molecular weight of 503.49 g/mol. Its IUPAC name is 13-(4-bromophenyl)-11-(4-methylphenyl)-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene.
| Compound Name | 13-(4-bromophenyl)-11-(4-methylphenyl)-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene |
|---|---|
| PubChem CID | 127051001 |
| Molecular Formula | C26H19BrN2S2 |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 13-(4-bromophenyl)-11-(4-methylphenyl)-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene |
| SMILES | Cc1ccc(C2C3=C(N=C4SC=C(c5ccc(Br)cc5)N42)c2ccccc2SC3)cc1 |
| InChI | InChI=1S/C26H19BrN2S2/c1-16-6-8-18(9-7-16)25-21-14-30-23-5-3-2-4-20(23)24(21)28-26-29(25)22(15-31-26)17-10-12-19(27)13-11-17/h2-13,15,25H,14H2,1H3 |
| InChIKey | QQQOSHTYMYWBNI-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |