C18H30N2 — CID 127051025
(1R,2S,9R,10R)-3-propyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene (PubChem CID 127051025) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is (1R,2S,9R,10R)-3-propyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene.
| Compound Name | (1R,2S,9R,10R)-3-propyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
|---|---|
| PubChem CID | 127051025 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | (1R,2S,9R,10R)-3-propyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
| SMILES | CCCN1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C18H30N2/c1-2-8-19-10-5-6-14-11-15-12-16(18(14)19)13-20-9-4-3-7-17(15)20/h11,15-18H,2-10,12-13H2,1H3/t15-,16+,17+,18+/m0/s1 |
| InChIKey | ZAZAIALTWQJJND-BSDSXHPESA-N |
| XLogP | 3.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|