C28H42O6 — CID 127051028
(2E,6Z)-10-[(2R,3R,5S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7-dimethyldeca-2,6-dien-5-one (PubChem CID 127051028) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is (2E,6Z)-10-[(2R,3R,5S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7-dimethyldeca-2,6-dien-5-one.
| Compound Name | (2E,6Z)-10-[(2R,3R,5S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7-dimethyldeca-2,6-dien-5-one |
|---|---|
| PubChem CID | 127051028 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (2E,6Z)-10-[(2R,3R,5S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7-dimethyldeca-2,6-dien-5-one |
| SMILES | COc1c(C)cc(O)cc1C/C=C(\C)CC(=O)/C=C(/C)CCC[C@@]1(C)O[C@H](C(C)(C)O)C[C@H]1O |
| InChI | InChI=1S/C28H42O6/c1-18(9-8-12-28(6)24(31)17-25(34-28)27(4,5)32)13-22(29)14-19(2)10-11-21-16-23(30)15-20(3)26(21)33-7/h10,13,15-16,24-25,30-32H,8-9,11-12,14,17H2,1-7H3/b18-13-,19-10+/t24-,25+,28-/m1/s1 |
| InChIKey | OXDWPYUQXXIRBJ-UAYNPCLSSA-N |
| XLogP | 4.95 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|