C29H35N3O3 — CID 127051043
9-benzyl-4-cyclohexyl-1-(4-methylbenzoyl)-1,4,9-triazaspiro[5.5]undecane-3,5-dione (PubChem CID 127051043) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 9-benzyl-4-cyclohexyl-1-(4-methylbenzoyl)-1,4,9-triazaspiro[5.5]undecane-3,5-dione.
| Compound Name | 9-benzyl-4-cyclohexyl-1-(4-methylbenzoyl)-1,4,9-triazaspiro[5.5]undecane-3,5-dione |
|---|---|
| PubChem CID | 127051043 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 9-benzyl-4-cyclohexyl-1-(4-methylbenzoyl)-1,4,9-triazaspiro[5.5]undecane-3,5-dione |
| SMILES | Cc1ccc(C(=O)N2CC(=O)N(C3CCCCC3)C(=O)C23CCN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C29H35N3O3/c1-22-12-14-24(15-13-22)27(34)31-21-26(33)32(25-10-6-3-7-11-25)28(35)29(31)16-18-30(19-17-29)20-23-8-4-2-5-9-23/h2,4-5,8-9,12-15,25H,3,6-7,10-11,16-21H2,1H3 |
| InChIKey | DQMQUKUXAXPUCX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|