C24H25N3O5 — CID 127051228
N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyhexanediamide (PubChem CID 127051228) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 127051228 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyhexanediamide |
| SMILES | Cc1noc(C)c1-c1cc(NC(=O)CCCCC(=O)NO)cc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25N3O5/c1-15-23(16(2)32-27-15)18-12-19(24(30)17-8-4-3-5-9-17)14-20(13-18)25-21(28)10-6-7-11-22(29)26-31/h3-5,8-9,12-14,31H,6-7,10-11H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | MXLBPUFZTKWCKX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|