C26H29N3O5 — CID 127051526
N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyoctanediamide (PubChem CID 127051526) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 127051526 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[3-benzoyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyoctanediamide |
| SMILES | Cc1noc(C)c1-c1cc(NC(=O)CCCCCCC(=O)NO)cc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H29N3O5/c1-17-25(18(2)34-29-17)20-14-21(26(32)19-10-6-5-7-11-19)16-22(15-20)27-23(30)12-8-3-4-9-13-24(31)28-33/h5-7,10-11,14-16,33H,3-4,8-9,12-13H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | VSUZBFWTCWWXDY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|