C18H23N3O4 — CID 127051527
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyheptanediamide (PubChem CID 127051527) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 127051527 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N'-hydroxyheptanediamide |
| SMILES | Cc1noc(C)c1-c1cccc(NC(=O)CCCCCC(=O)NO)c1 |
| InChI | InChI=1S/C18H23N3O4/c1-12-18(13(2)25-21-12)14-7-6-8-15(11-14)19-16(22)9-4-3-5-10-17(23)20-24/h6-8,11,24H,3-5,9-10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | AYZFKKHGXUUTCY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|