About ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate
ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate (PubChem CID 127051603) has the molecular formula C21H23Br2NO5
and a molecular weight of 529.23 g/mol. Its IUPAC name is ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate |
| PubChem CID | 127051603 |
| Molecular Formula | C21H23Br2NO5 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1cc(Br)c(Oc2ccc(O)c(C(C)C)c2)c(Br)c1 |
| InChI | InChI=1S/C21H23Br2NO5/c1-4-28-20(27)8-7-19(26)24-13-9-16(22)21(17(23)10-13)29-14-5-6-18(25)15(11-14)12(2)3/h5-6,9-12,25H,4,7-8H2,1-3H3,(H,24,26) |
| InChIKey | YZVBHCBSKUEZNE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate?
The IUPAC name of ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate (CID 127051603) is ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate.
What is the SMILES notation for ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate?
The canonical SMILES for ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate is CCOC(=O)CCC(=O)Nc1cc(Br)c(Oc2ccc(O)c(C(C)C)c2)c(Br)c1.
What is the InChIKey of ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate?
The InChIKey is YZVBHCBSKUEZNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Br2NO5/c1-4-28-20(27)8-7-19(26)24-13-9-16(22)21(17(23)10-13)29-14-5-6-18(25)15(11-14)12(2)3/h5-6,9-12,25H,4,7-8H2,1-3H3,(H,24,26).
What are the key properties of ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate?
ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate has a molecular weight of 529.23 g/mol, XLogP of 6.11, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)anilino]-4-oxobutanoate is sourced from PubChem (CID 127051603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).