C24H48NO7P — CID 127051629
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-methoxypropyl] (Z)-octadec-9-enoate (PubChem CID 127051629) has the molecular formula C24H48NO7P and a molecular weight of 493.62 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-methoxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-methoxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 127051629 |
| Molecular Formula | C24H48NO7P |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-methoxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC |
| InChI | InChI=1S/C24H48NO7P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(26)30-21-23(29-2)22-32-33(27,28)31-20-19-25/h10-11,23H,3-9,12-22,25H2,1-2H3,(H,27,28)/b11-10- |
| InChIKey | BPIYQPASLZUFAF-KHPPLWFESA-N |
| XLogP | 5.67 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|