About (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one
(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one (PubChem CID 127051688) has the molecular formula C25H21N3O2
and a molecular weight of 395.46 g/mol. Its IUPAC name is (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one |
| PubChem CID | 127051688 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one |
| SMILES | COc1ccc(N/C=C\C(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O2/c1-30-22-14-12-20(13-15-22)26-17-16-24(29)23-18-28(21-10-6-3-7-11-21)27-25(23)19-8-4-2-5-9-19/h2-18,26H,1H3/b17-16- |
| InChIKey | OVHCUFGCGXLQDV-MSUUIHNZSA-N |
| XLogP | 5.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one?
The IUPAC name of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one (CID 127051688) is (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one.
What is the SMILES notation for (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one?
The canonical SMILES for (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one is COc1ccc(N/C=C\C(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1.
What is the InChIKey of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one?
The InChIKey is OVHCUFGCGXLQDV-MSUUIHNZSA-N. The full InChI is InChI=1S/C25H21N3O2/c1-30-22-14-12-20(13-15-22)26-17-16-24(29)23-18-28(21-10-6-3-7-11-21)27-25(23)19-8-4-2-5-9-19/h2-18,26H,1H3/b17-16-.
What are the key properties of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one?
(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one has a molecular weight of 395.46 g/mol, XLogP of 5.36, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-methoxyanilino)prop-2-en-1-one is sourced from PubChem (CID 127051688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).