C25H17BrN2S2 — CID 127051890
13-(4-bromophenyl)-11-phenyl-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene (PubChem CID 127051890) has the molecular formula C25H17BrN2S2 and a molecular weight of 489.46 g/mol. Its IUPAC name is 13-(4-bromophenyl)-11-phenyl-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene.
| Compound Name | 13-(4-bromophenyl)-11-phenyl-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene |
|---|---|
| PubChem CID | 127051890 |
| Molecular Formula | C25H17BrN2S2 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 13-(4-bromophenyl)-11-phenyl-8,15-dithia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaene |
| SMILES | Brc1ccc(C2=CSC3=NC4=C(CSc5ccccc54)C(c4ccccc4)N23)cc1 |
| InChI | InChI=1S/C25H17BrN2S2/c26-18-12-10-16(11-13-18)21-15-30-25-27-23-19-8-4-5-9-22(19)29-14-20(23)24(28(21)25)17-6-2-1-3-7-17/h1-13,15,24H,14H2 |
| InChIKey | CGRCUFAOBDSJHA-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |