About ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate
ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate (PubChem CID 127051914) has the molecular formula C18H14Cl2F3NO5
and a molecular weight of 452.21 g/mol. Its IUPAC name is ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate |
| PubChem CID | 127051914 |
| Molecular Formula | C18H14Cl2F3NO5 |
| Molecular Weight | 452.21 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2F3NO5/c1-2-28-16(27)8-15(26)24-9-5-12(19)17(13(20)6-9)29-10-3-4-14(25)11(7-10)18(21,22)23/h3-7,25H,2,8H2,1H3,(H,24,26) |
| InChIKey | UULIPWKBIJHVOQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.21 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate?
The IUPAC name of ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate (CID 127051914) is ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate?
The canonical SMILES for ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate is CCOC(=O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(C(F)(F)F)c2)c(Cl)c1.
What is the InChIKey of ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate?
The InChIKey is UULIPWKBIJHVOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2F3NO5/c1-2-28-16(27)8-15(26)24-9-5-12(19)17(13(20)6-9)29-10-3-4-14(25)11(7-10)18(21,22)23/h3-7,25H,2,8H2,1H3,(H,24,26).
What are the key properties of ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate?
ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate has a molecular weight of 452.21 g/mol, XLogP of 5.40, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3,5-dichloro-4-[4-hydroxy-3-(trifluoromethyl)phenoxy]anilino]-3-oxopropanoate is sourced from PubChem (CID 127051914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).