About 3-chloropyridazine-4,5-diamine
3-chloropyridazine-4,5-diamine (PubChem CID 12705218) has the molecular formula C4H5ClN4
and a molecular weight of 144.57 g/mol. Its IUPAC name is 3-chloropyridazine-4,5-diamine.
Molecular Properties
| Compound Name | 3-chloropyridazine-4,5-diamine |
| PubChem CID | 12705218 |
| Molecular Formula | C4H5ClN4 |
| Molecular Weight | 144.57 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | 3-chloropyridazine-4,5-diamine |
| SMILES | Nc1cnnc(Cl)c1N |
| InChI | InChI=1S/C4H5ClN4/c5-4-3(7)2(6)1-8-9-4/h1H,(H2,6,9)(H2,7,8) |
| InChIKey | SAHWCNYANVMMER-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.57 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloropyridazine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropyridazine-4,5-diamine?
The IUPAC name of 3-chloropyridazine-4,5-diamine (CID 12705218) is 3-chloropyridazine-4,5-diamine.
What is the SMILES notation for 3-chloropyridazine-4,5-diamine?
The canonical SMILES for 3-chloropyridazine-4,5-diamine is Nc1cnnc(Cl)c1N.
What is the InChIKey of 3-chloropyridazine-4,5-diamine?
The InChIKey is SAHWCNYANVMMER-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN4/c5-4-3(7)2(6)1-8-9-4/h1H,(H2,6,9)(H2,7,8).
What are the key properties of 3-chloropyridazine-4,5-diamine?
3-chloropyridazine-4,5-diamine has a molecular weight of 144.57 g/mol, XLogP of 0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropyridazine-4,5-diamine is sourced from PubChem (CID 12705218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).