C20H40O7P2 — CID 127052203
phosphono [(2E,6E)-3,7,11,15-tetramethylhexadeca-2,6-dienyl] hydrogen phosphate (PubChem CID 127052203) has the molecular formula C20H40O7P2 and a molecular weight of 454.48 g/mol. Its IUPAC name is phosphono [(2E,6E)-3,7,11,15-tetramethylhexadeca-2,6-dienyl] hydrogen phosphate.
| Compound Name | phosphono [(2E,6E)-3,7,11,15-tetramethylhexadeca-2,6-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 127052203 |
| Molecular Formula | C20H40O7P2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | phosphono [(2E,6E)-3,7,11,15-tetramethylhexadeca-2,6-dienyl] hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H40O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h13,15,17-18H,6-12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/b19-13+,20-15+ |
| InChIKey | SLKJXECFTOCYOR-YLYRKCBPSA-N |
| XLogP | 6.52 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|