C31H42N2O4 — CID 127052317
ethyl (3S,4R,5S)-1-benzyl-4-(4-methylphenyl)-2-oxo-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate (PubChem CID 127052317) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is ethyl (3S,4R,5S)-1-benzyl-4-(4-methylphenyl)-2-oxo-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R,5S)-1-benzyl-4-(4-methylphenyl)-2-oxo-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate |
|---|---|
| PubChem CID | 127052317 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | ethyl (3S,4R,5S)-1-benzyl-4-(4-methylphenyl)-2-oxo-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(Cc2ccccc2)C[C@@H](ON2C(C)(C)CCCC2(C)C)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C31H42N2O4/c1-7-36-29(35)27-26(24-16-14-22(2)15-17-24)25(37-33-30(3,4)18-11-19-31(33,5)6)21-32(28(27)34)20-23-12-9-8-10-13-23/h8-10,12-17,25-27H,7,11,18-21H2,1-6H3/t25-,26-,27+/m1/s1 |
| InChIKey | IUILTEARGSAPIC-PFBJBMPXSA-N |
| XLogP | 5.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|