About 1-methyl-2,2-dipropoxypyrrolidine
1-methyl-2,2-dipropoxypyrrolidine (PubChem CID 12705232) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-methyl-2,2-dipropoxypyrrolidine.
Molecular Properties
| Compound Name | 1-methyl-2,2-dipropoxypyrrolidine |
| PubChem CID | 12705232 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-methyl-2,2-dipropoxypyrrolidine |
| SMILES | CCCOC1(OCCC)CCCN1C |
| InChI | InChI=1S/C11H23NO2/c1-4-9-13-11(14-10-5-2)7-6-8-12(11)3/h4-10H2,1-3H3 |
| InChIKey | XAOANTATTUUECM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,2-dipropoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,2-dipropoxypyrrolidine?
The IUPAC name of 1-methyl-2,2-dipropoxypyrrolidine (CID 12705232) is 1-methyl-2,2-dipropoxypyrrolidine.
What is the SMILES notation for 1-methyl-2,2-dipropoxypyrrolidine?
The canonical SMILES for 1-methyl-2,2-dipropoxypyrrolidine is CCCOC1(OCCC)CCCN1C.
What is the InChIKey of 1-methyl-2,2-dipropoxypyrrolidine?
The InChIKey is XAOANTATTUUECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-4-9-13-11(14-10-5-2)7-6-8-12(11)3/h4-10H2,1-3H3.
What are the key properties of 1-methyl-2,2-dipropoxypyrrolidine?
1-methyl-2,2-dipropoxypyrrolidine has a molecular weight of 201.31 g/mol, XLogP of 2.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,2-dipropoxypyrrolidine is sourced from PubChem (CID 12705232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).