C16H33ClO6S — CID 127052423
(2R,3S,4S)-1-[(2S,3S)-3-heptoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride (PubChem CID 127052423) has the molecular formula C16H33ClO6S and a molecular weight of 388.95 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S,3S)-3-heptoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride.
| Compound Name | (2R,3S,4S)-1-[(2S,3S)-3-heptoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
|---|---|
| PubChem CID | 127052423 |
| Molecular Formula | C16H33ClO6S |
| Molecular Weight | 388.95 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2R,3S,4S)-1-[(2S,3S)-3-heptoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
| SMILES | CCCCCCCO[C@@H](CO)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO.[Cl-] |
| InChI | InChI=1S/C16H33O6S.ClH/c1-2-3-4-5-6-7-22-14(8-17)12(19)10-23-11-13(20)16(21)15(23)9-18;/h12-21H,2-11H2,1H3;1H/q+1;/p-1/t12-,13-,14+,15-,16+,23?;/m1./s1 |
| InChIKey | WGLSRNVVLXIYTO-HPCKVWKKSA-M |
| XLogP | -3.59 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.95 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|