C13H22O4 — CID 127052432
(2S,3R)-1-[(1R,4R,5R,8S)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-3-hydroxy-2-methylbutan-1-one (PubChem CID 127052432) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2S,3R)-1-[(1R,4R,5R,8S)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-3-hydroxy-2-methylbutan-1-one.
| Compound Name | (2S,3R)-1-[(1R,4R,5R,8S)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-3-hydroxy-2-methylbutan-1-one |
|---|---|
| PubChem CID | 127052432 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2S,3R)-1-[(1R,4R,5R,8S)-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octan-4-yl]-3-hydroxy-2-methylbutan-1-one |
| SMILES | C[C@H](C(=O)[C@H]1CO[C@@]2(C)OC[C@@H]1[C@@H]2C)[C@@H](C)O |
| InChI | InChI=1S/C13H22O4/c1-7(9(3)14)12(15)11-6-17-13(4)8(2)10(11)5-16-13/h7-11,14H,5-6H2,1-4H3/t7-,8-,9+,10+,11-,13+/m0/s1 |
| InChIKey | RLTGJZSHBMKGOY-URASHGAGSA-N |
| XLogP | 1.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |