C13H24O4 — CID 127052433
(2S)-1-[(2S,3S,4R,5S,6S)-2-hydroxy-4-(hydroxymethyl)-5,6-dimethyloxan-3-yl]-2-methylbutan-1-one (PubChem CID 127052433) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2S)-1-[(2S,3S,4R,5S,6S)-2-hydroxy-4-(hydroxymethyl)-5,6-dimethyloxan-3-yl]-2-methylbutan-1-one.
| Compound Name | (2S)-1-[(2S,3S,4R,5S,6S)-2-hydroxy-4-(hydroxymethyl)-5,6-dimethyloxan-3-yl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 127052433 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (2S)-1-[(2S,3S,4R,5S,6S)-2-hydroxy-4-(hydroxymethyl)-5,6-dimethyloxan-3-yl]-2-methylbutan-1-one |
| SMILES | CC[C@H](C)C(=O)[C@H]1[C@H](CO)[C@H](C)[C@H](C)O[C@@H]1O |
| InChI | InChI=1S/C13H24O4/c1-5-7(2)12(15)11-10(6-14)8(3)9(4)17-13(11)16/h7-11,13-14,16H,5-6H2,1-4H3/t7-,8+,9-,10+,11+,13-/m0/s1 |
| InChIKey | NBASOICTCXAKEZ-HYDVQPLPSA-N |
| XLogP | 1.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |