C23H38O5 — CID 127052478
4-[[(2R,4aS,4bS,7S,8S,8aS,10aR)-7-(methoxymethyl)-4a,7,8-trimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]oxy]-4-oxobutanoic acid (PubChem CID 127052478) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 4-[[(2R,4aS,4bS,7S,8S,8aS,10aR)-7-(methoxymethyl)-4a,7,8-trimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R,4aS,4bS,7S,8S,8aS,10aR)-7-(methoxymethyl)-4a,7,8-trimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 127052478 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-[[(2R,4aS,4bS,7S,8S,8aS,10aR)-7-(methoxymethyl)-4a,7,8-trimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]oxy]-4-oxobutanoic acid |
| SMILES | COC[C@@]1(C)CC[C@H]2[C@@H](CC[C@@H]3C[C@H](OC(=O)CCC(=O)O)CC[C@@]32C)[C@@H]1C |
| InChI | InChI=1S/C23H38O5/c1-15-18-6-5-16-13-17(28-21(26)8-7-20(24)25)9-12-23(16,3)19(18)10-11-22(15,2)14-27-4/h15-19H,5-14H2,1-4H3,(H,24,25)/t15-,16+,17+,18-,19-,22+,23-/m0/s1 |
| InChIKey | IRGDTFDMPBWMMN-NLMUFCCYSA-N |
| XLogP | 4.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |