C20H19N3O — CID 127052549
4-(7-methoxypyrrolo[1,2-a]quinoxalin-4-yl)-N,N-dimethylaniline (PubChem CID 127052549) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(7-methoxypyrrolo[1,2-a]quinoxalin-4-yl)-N,N-dimethylaniline.
| Compound Name | 4-(7-methoxypyrrolo[1,2-a]quinoxalin-4-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 127052549 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-(7-methoxypyrrolo[1,2-a]quinoxalin-4-yl)-N,N-dimethylaniline |
| SMILES | COc1ccc2c(c1)nc(-c1ccc(N(C)C)cc1)c1cccn12 |
| InChI | InChI=1S/C20H19N3O/c1-22(2)15-8-6-14(7-9-15)20-19-5-4-12-23(19)18-11-10-16(24-3)13-17(18)21-20/h4-13H,1-3H3 |
| InChIKey | XJEFYPYKUYMHFJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |