C19H23ClFN — CID 127052757
2-[4-(4-fluorophenyl)butyl]-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 127052757) has the molecular formula C19H23ClFN and a molecular weight of 319.85 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)butyl]-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 2-[4-(4-fluorophenyl)butyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 127052757 |
| Molecular Formula | C19H23ClFN |
| Molecular Weight | 319.85 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[4-(4-fluorophenyl)butyl]-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | Cl.Fc1ccc(CCCCN2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H22FN.ClH/c20-19-10-8-16(9-11-19)5-3-4-13-21-14-12-17-6-1-2-7-18(17)15-21;/h1-2,6-11H,3-5,12-15H2;1H |
| InChIKey | ABCIREFWVKRPQQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|