C11H16FN2O14P3 — CID 127052777
[[(2R,3S,4R,5S)-5-(2-carbamoyl-3-fluoro-4-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 127052777) has the molecular formula C11H16FN2O14P3 and a molecular weight of 512.17 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-(2-carbamoyl-3-fluoro-4-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-5-(2-carbamoyl-3-fluoro-4-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 127052777 |
| Molecular Formula | C11H16FN2O14P3 |
| Molecular Weight | 512.17 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-(2-carbamoyl-3-fluoro-4-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)c1nccc([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c1F |
| InChI | InChI=1S/C11H16FN2O14P3/c12-6-4(1-2-14-7(6)11(13)17)10-9(16)8(15)5(26-10)3-25-30(21,22)28-31(23,24)27-29(18,19)20/h1-2,5,8-10,15-16H,3H2,(H2,13,17)(H,21,22)(H,23,24)(H2,18,19,20)/t5-,8-,9-,10+/m1/s1 |
| InChIKey | OSKGOYJWSHDTGH-KBHCAIDQSA-N |
| XLogP | -1.18 |
| TPSA | 265.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.17 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|