About 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone
1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone (PubChem CID 127052824) has the molecular formula C17H22N2O3S
and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone |
| PubChem CID | 127052824 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone |
| SMILES | COc1ccc(CCSCC(=O)c2noc(C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-17(2,3)16-18-15(19-22-16)14(20)11-23-10-9-12-5-7-13(21-4)8-6-12/h5-8H,9-11H2,1-4H3 |
| InChIKey | UHRXMIQRNQXSAA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone?
The IUPAC name of 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone (CID 127052824) is 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone.
What is the SMILES notation for 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone?
The canonical SMILES for 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone is COc1ccc(CCSCC(=O)c2noc(C(C)(C)C)n2)cc1.
What is the InChIKey of 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone?
The InChIKey is UHRXMIQRNQXSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3S/c1-17(2,3)16-18-15(19-22-16)14(20)11-23-10-9-12-5-7-13(21-4)8-6-12/h5-8H,9-11H2,1-4H3.
What are the key properties of 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone?
1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone has a molecular weight of 334.44 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]ethanone is sourced from PubChem (CID 127052824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).