About 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol
4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol (PubChem CID 127052833) has the molecular formula C19H17N3O
and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol.
Molecular Properties
| Compound Name | 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol |
| PubChem CID | 127052833 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol |
| SMILES | CN(C)c1ccc(-c2nc3cc(O)ccc3n3cccc23)cc1 |
| InChI | InChI=1S/C19H17N3O/c1-21(2)14-7-5-13(6-8-14)19-18-4-3-11-22(18)17-10-9-15(23)12-16(17)20-19/h3-12,23H,1-2H3 |
| InChIKey | AGEXPMNIPQBGOW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol?
The IUPAC name of 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol (CID 127052833) is 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol.
What is the SMILES notation for 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol?
The canonical SMILES for 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol is CN(C)c1ccc(-c2nc3cc(O)ccc3n3cccc23)cc1.
What is the InChIKey of 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol?
The InChIKey is AGEXPMNIPQBGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O/c1-21(2)14-7-5-13(6-8-14)19-18-4-3-11-22(18)17-10-9-15(23)12-16(17)20-19/h3-12,23H,1-2H3.
What are the key properties of 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol?
4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol has a molecular weight of 303.37 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(dimethylamino)phenyl]pyrrolo[1,2-a]quinoxalin-7-ol is sourced from PubChem (CID 127052833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).