C25H25N3O2 — CID 127052874
4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline (PubChem CID 127052874) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 127052874 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenyl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CC(c3ccc4c(c3)OCCO4)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-27(2)20-11-8-18(9-12-20)23-17-22(26-28(23)21-6-4-3-5-7-21)19-10-13-24-25(16-19)30-15-14-29-24/h3-13,16,23H,14-15,17H2,1-2H3 |
| InChIKey | XYBLZFUVTDZOBZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|