C25H24Cl2N2O7S — CID 127052916
N-[(3R,4R,5S,6R)-6-[[(2,3-dichlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide (PubChem CID 127052916) has the molecular formula C25H24Cl2N2O7S and a molecular weight of 567.45 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-6-[[(2,3-dichlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide.
| Compound Name | N-[(3R,4R,5S,6R)-6-[[(2,3-dichlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 127052916 |
| Molecular Formula | C25H24Cl2N2O7S |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | N-[(3R,4R,5S,6R)-6-[[(2,3-dichlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide |
| SMILES | O=C(N[C@H]1C(O)O[C@H](CNS(=O)(=O)c2cccc(Cl)c2Cl)[C@@H](O)[C@@H]1O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H24Cl2N2O7S/c26-17-10-5-11-19(20(17)27)37(34,35)28-13-18-22(30)23(31)21(25(33)36-18)29-24(32)16-9-4-8-15(12-16)14-6-2-1-3-7-14/h1-12,18,21-23,25,28,30-31,33H,13H2,(H,29,32)/t18-,21-,22-,23-,25?/m1/s1 |
| InChIKey | IXEYHLHOLROZNK-BVGQCQFASA-N |
| XLogP | 2.18 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |