C17H16FNO3 — CID 127053089
ethyl (1'S,2'R,3R,4'R)-5-fluoro-2-oxospiro[1H-indole-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate (PubChem CID 127053089) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is ethyl (1'S,2'R,3R,4'R)-5-fluoro-2-oxospiro[1H-indole-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate.
| Compound Name | ethyl (1'S,2'R,3R,4'R)-5-fluoro-2-oxospiro[1H-indole-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate |
|---|---|
| PubChem CID | 127053089 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl (1'S,2'R,3R,4'R)-5-fluoro-2-oxospiro[1H-indole-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C=C[C@@H](C2)[C@@]12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C17H16FNO3/c1-2-22-15(20)14-9-3-4-10(7-9)17(14)12-8-11(18)5-6-13(12)19-16(17)21/h3-6,8-10,14H,2,7H2,1H3,(H,19,21)/t9-,10+,14+,17+/m1/s1 |
| InChIKey | QJNJHDCEOOIAKT-AMIOVWLRSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|