C17H16O3S — CID 127053098
ethyl (1'S,2'S,3S,4'R)-2-oxospiro[1-benzothiophene-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate (PubChem CID 127053098) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is ethyl (1'S,2'S,3S,4'R)-2-oxospiro[1-benzothiophene-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate.
| Compound Name | ethyl (1'S,2'S,3S,4'R)-2-oxospiro[1-benzothiophene-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate |
|---|---|
| PubChem CID | 127053098 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | ethyl (1'S,2'S,3S,4'R)-2-oxospiro[1-benzothiophene-3,3'-bicyclo[2.2.1]hept-5-ene]-2'-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2C=C[C@@H](C2)[C@]12C(=O)Sc1ccccc12 |
| InChI | InChI=1S/C17H16O3S/c1-2-20-15(18)14-10-7-8-11(9-10)17(14)12-5-3-4-6-13(12)21-16(17)19/h3-8,10-11,14H,2,9H2,1H3/t10-,11+,14-,17-/m1/s1 |
| InChIKey | ZWQQKQUROAWFED-KOZDUTSQSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|