About 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide
4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide (PubChem CID 127053441) has the molecular formula C29H25N3OS
and a molecular weight of 463.61 g/mol. Its IUPAC name is 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide.
Molecular Properties
| Compound Name | 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide |
| PubChem CID | 127053441 |
| Molecular Formula | C29H25N3OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide |
| SMILES | Cc1cccc(NC(=O)CCCSc2nc(-c3ccccc3)cc(-c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C29H25N3OS/c1-21-10-8-15-24(18-21)31-28(33)16-9-17-34-29-26(20-30)25(22-11-4-2-5-12-22)19-27(32-29)23-13-6-3-7-14-23/h2-8,10-15,18-19H,9,16-17H2,1H3,(H,31,33) |
| InChIKey | VFGOWMALACJOJF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide?
The IUPAC name of 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide (CID 127053441) is 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide.
What is the SMILES notation for 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide?
The canonical SMILES for 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide is Cc1cccc(NC(=O)CCCSc2nc(-c3ccccc3)cc(-c3ccccc3)c2C#N)c1.
What is the InChIKey of 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide?
The InChIKey is VFGOWMALACJOJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25N3OS/c1-21-10-8-15-24(18-21)31-28(33)16-9-17-34-29-26(20-30)25(22-11-4-2-5-12-22)19-27(32-29)23-13-6-3-7-14-23/h2-8,10-15,18-19H,9,16-17H2,1H3,(H,31,33).
What are the key properties of 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide?
4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide has a molecular weight of 463.61 g/mol, XLogP of 7.11, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-methylphenyl)butanamide is sourced from PubChem (CID 127053441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).